C19H23N3O3 — CID 95570380
N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 95570380) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95570380 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1ccccc1[C@H](CNC(=O)c1ccc(=O)[nH]c1)N1CCCC1 |
| InChI | InChI=1S/C19H23N3O3/c1-25-17-7-3-2-6-15(17)16(22-10-4-5-11-22)13-21-19(24)14-8-9-18(23)20-12-14/h2-3,6-9,12,16H,4-5,10-11,13H2,1H3,(H,20,23)(H,21,24)/t16-/m0/s1 |
| InChIKey | WRVUPHTXXRAYKB-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |