C24H31N3O4S — CID 41187538
N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 41187538) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41187538 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccccc1[C@H](CNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)N1CCCC1 |
| InChI | InChI=1S/C24H31N3O4S/c1-31-23-9-3-2-8-21(23)22(26-14-4-5-15-26)18-25-24(28)19-10-12-20(13-11-19)32(29,30)27-16-6-7-17-27/h2-3,8-13,22H,4-7,14-18H2,1H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | KQEPXKYGAHBFNI-QFIPXVFZSA-N |
| XLogP | 3.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |