C22H26F2N2O4S — CID 60533875
4-(difluoromethylsulfonyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide (PubChem CID 60533875) has the molecular formula C22H26F2N2O4S and a molecular weight of 452.52 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 60533875 |
| Molecular Formula | C22H26F2N2O4S |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide |
| SMILES | COc1ccccc1C(CNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H26F2N2O4S/c1-30-20-8-4-3-7-18(20)19(26-13-5-2-6-14-26)15-25-21(27)16-9-11-17(12-10-16)31(28,29)22(23)24/h3-4,7-12,19,22H,2,5-6,13-15H2,1H3,(H,25,27) |
| InChIKey | XDEHRKGMMLQBGB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |