C25H32N2O4 — CID 55950107
3-methoxy-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide (PubChem CID 55950107) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-methoxy-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide.
| Compound Name | 3-methoxy-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 55950107 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3-methoxy-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NCC(c2ccccc2OC)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C25H32N2O4/c1-4-16-31-23-13-12-19(17-24(23)30-3)25(28)26-18-21(27-14-8-5-9-15-27)20-10-6-7-11-22(20)29-2/h4,6-7,10-13,17,21H,1,5,8-9,14-16,18H2,2-3H3,(H,26,28) |
| InChIKey | HQVKQXVNNMLAGD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|