C22H28N2O3 — CID 110357424
3,4-dimethoxy-N-(2-phenyl-2-piperidin-1-ylethyl)benzamide (PubChem CID 110357424) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-phenyl-2-piperidin-1-ylethyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(2-phenyl-2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 110357424 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3,4-dimethoxy-N-(2-phenyl-2-piperidin-1-ylethyl)benzamide |
| SMILES | COc1ccc(C(=O)NCC(c2ccccc2)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C22H28N2O3/c1-26-20-12-11-18(15-21(20)27-2)22(25)23-16-19(17-9-5-3-6-10-17)24-13-7-4-8-14-24/h3,5-6,9-12,15,19H,4,7-8,13-14,16H2,1-2H3,(H,23,25) |
| InChIKey | ZJPKYWFDQSIBTR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |