C23H30N2O3 — CID 112505140
N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]-3-methylbenzamide (PubChem CID 112505140) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]-3-methylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 112505140 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]-3-methylbenzamide |
| SMILES | COc1ccc(C(CNC(=O)c2cccc(C)c2)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C23H30N2O3/c1-17-8-7-9-19(14-17)23(26)24-16-20(25-12-5-4-6-13-25)18-10-11-21(27-2)22(15-18)28-3/h7-11,14-15,20H,4-6,12-13,16H2,1-3H3,(H,24,26) |
| InChIKey | KDWBBHBEVHEUOW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |