C22H26N2O5 — CID 42457132
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3,4-dimethoxybenzamide (PubChem CID 42457132) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 42457132 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H](c2ccc3c(c2)OCO3)N2CCCC2)cc1OC |
| InChI | InChI=1S/C22H26N2O5/c1-26-18-7-6-16(12-20(18)27-2)22(25)23-13-17(24-9-3-4-10-24)15-5-8-19-21(11-15)29-14-28-19/h5-8,11-12,17H,3-4,9-10,13-14H2,1-2H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | NOYYYJKJECIXSD-QGZVFWFLSA-N |
| XLogP | 3.00 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |