C22H27N3O3 — CID 7496489
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 7496489) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 7496489 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)c2ccc3c(c2)OCO3)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-24(2)18-8-5-16(6-9-18)19(25-11-3-4-12-25)14-23-22(26)17-7-10-20-21(13-17)28-15-27-20/h5-10,13,19H,3-4,11-12,14-15H2,1-2H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | FIHJWTAPVRWKJA-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|