C22H28FN3O — CID 112506893
N-[2-[4-(dimethylamino)phenyl]-2-piperidin-1-ylethyl]-3-fluorobenzamide (PubChem CID 112506893) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-piperidin-1-ylethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-piperidin-1-ylethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 112506893 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-piperidin-1-ylethyl]-3-fluorobenzamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2cccc(F)c2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28FN3O/c1-25(2)20-11-9-17(10-12-20)21(26-13-4-3-5-14-26)16-24-22(27)18-7-6-8-19(23)15-18/h6-12,15,21H,3-5,13-14,16H2,1-2H3,(H,24,27) |
| InChIKey | VSKVXBHOCSDEAB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|