C24H33N3O4 — CID 7496210
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,4,5-trimethoxybenzamide (PubChem CID 7496210) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7496210 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@H](c2ccc(N(C)C)cc2)N2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H33N3O4/c1-26(2)19-10-8-17(9-11-19)20(27-12-6-7-13-27)16-25-24(28)18-14-21(29-3)23(31-5)22(15-18)30-4/h8-11,14-15,20H,6-7,12-13,16H2,1-5H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | XPNGTGBLPMXSOY-HXUWFJFHSA-N |
| XLogP | 3.35 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|