C21H25F2N3O — CID 7496297
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2,6-difluorobenzamide (PubChem CID 7496297) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2,6-difluorobenzamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 7496297 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2,6-difluorobenzamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2c(F)cccc2F)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25F2N3O/c1-25(2)16-10-8-15(9-11-16)19(26-12-3-4-13-26)14-24-21(27)20-17(22)6-5-7-18(20)23/h5-11,19H,3-4,12-14H2,1-2H3,(H,24,27)/t19-/m1/s1 |
| InChIKey | CSXIIFMTCINDHV-LJQANCHMSA-N |
| XLogP | 3.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|