C21H27FN4O — CID 43956378
1-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3-(4-fluorophenyl)urea (PubChem CID 43956378) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 43956378 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3-(4-fluorophenyl)urea |
| SMILES | CN(C)c1ccc(C(CNC(=O)Nc2ccc(F)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H27FN4O/c1-25(2)19-11-5-16(6-12-19)20(26-13-3-4-14-26)15-23-21(27)24-18-9-7-17(22)8-10-18/h5-12,20H,3-4,13-15H2,1-2H3,(H2,23,24,27) |
| InChIKey | KRUZFMGUXUUROS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|