C21H26FN3O2 — CID 43016379
1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]urea (PubChem CID 43016379) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]urea |
|---|---|
| PubChem CID | 43016379 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]urea |
| SMILES | COc1ccc(C(CNC(=O)Nc2ccc(F)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H26FN3O2/c1-27-19-11-5-16(6-12-19)20(25-13-3-2-4-14-25)15-23-21(26)24-18-9-7-17(22)8-10-18/h5-12,20H,2-4,13-15H2,1H3,(H2,23,24,26) |
| InChIKey | XKCQSIQAQQCORE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |