C23H26FN3O2 — CID 39982579
5-fluoro-N-[(2R)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-1H-indole-2-carboxamide (PubChem CID 39982579) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 5-fluoro-N-[(2R)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[(2R)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39982579 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5-fluoro-N-[(2R)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc([C@H](CNC(=O)c2cc3cc(F)ccc3[nH]2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26FN3O2/c1-29-19-8-5-16(6-9-19)22(27-11-3-2-4-12-27)15-25-23(28)21-14-17-13-18(24)7-10-20(17)26-21/h5-10,13-14,22,26H,2-4,11-12,15H2,1H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | PLTHLILPIJDRSU-QFIPXVFZSA-N |
| XLogP | 4.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |