C23H25FN4O2S — CID 24544205
3-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 24544205) has the molecular formula C23H25FN4O2S and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 24544205 |
| Molecular Formula | C23H25FN4O2S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)c2c[nH]c(=S)n2-c2ccc(F)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H25FN4O2S/c1-30-19-10-4-16(5-11-19)20(27-12-2-3-13-27)14-25-22(29)21-15-26-23(31)28(21)18-8-6-17(24)7-9-18/h4-11,15,20H,2-3,12-14H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | ARWDLCVLUORAOT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|