C23H27FN2O3 — CID 110623858
N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4-methoxyphenyl)-4-oxobutanamide (PubChem CID 110623858) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4-methoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4-methoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110623858 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4-methoxyphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)NCC(c2ccc(F)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H27FN2O3/c1-29-20-10-6-18(7-11-20)22(27)12-13-23(28)25-16-21(26-14-2-3-15-26)17-4-8-19(24)9-5-17/h4-11,21H,2-3,12-16H2,1H3,(H,25,28) |
| InChIKey | GMSZTDZMGSCRBS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |