C25H32N2O4 — CID 55328450
4-(4-ethoxyphenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide (PubChem CID 55328450) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide.
| Compound Name | 4-(4-ethoxyphenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 55328450 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)NCC(c2ccc(OC)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-3-31-22-12-8-20(9-13-22)24(28)14-15-25(29)26-18-23(27-16-4-5-17-27)19-6-10-21(30-2)11-7-19/h6-13,23H,3-5,14-18H2,1-2H3,(H,26,29) |
| InChIKey | GDOPMEAMNMKEAS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |