C21H25F2N3O3 — CID 55695296
1-[4-(difluoromethoxy)phenyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea (PubChem CID 55695296) has the molecular formula C21H25F2N3O3 and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea |
|---|---|
| PubChem CID | 55695296 |
| Molecular Formula | C21H25F2N3O3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea |
| SMILES | COc1ccccc1C(CNC(=O)Nc1ccc(OC(F)F)cc1)N1CCCC1 |
| InChI | InChI=1S/C21H25F2N3O3/c1-28-19-7-3-2-6-17(19)18(26-12-4-5-13-26)14-24-21(27)25-15-8-10-16(11-9-15)29-20(22)23/h2-3,6-11,18,20H,4-5,12-14H2,1H3,(H2,24,25,27) |
| InChIKey | HLDVTHFBIVKCNW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |