C20H23F2N3OS — CID 8657164
1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea (PubChem CID 8657164) has the molecular formula C20H23F2N3OS and a molecular weight of 391.49 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8657164 |
| Molecular Formula | C20H23F2N3OS |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea |
| SMILES | FC(F)Oc1ccc(NC(=S)NC[C@@H](c2ccccc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H23F2N3OS/c21-19(22)26-17-10-8-16(9-11-17)24-20(27)23-14-18(25-12-4-5-13-25)15-6-2-1-3-7-15/h1-3,6-11,18-19H,4-5,12-14H2,(H2,23,24,27)/t18-/m0/s1 |
| InChIKey | DYCFXZJKKZZFSM-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|