C22H29N3OS — CID 8683575
1-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(3-methylphenyl)thiourea (PubChem CID 8683575) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8683575 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(3-methylphenyl)thiourea |
| SMILES | COc1ccc([C@@H](CNC(=S)Nc2cccc(C)c2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c1-17-7-6-8-19(15-17)24-22(27)23-16-21(25-13-4-3-5-14-25)18-9-11-20(26-2)12-10-18/h6-12,15,21H,3-5,13-14,16H2,1-2H3,(H2,23,24,27)/t21-/m1/s1 |
| InChIKey | SFQTZISLGWZAJA-OAQYLSRUSA-N |
| XLogP | 4.52 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|