C21H25F2N3OS2 — CID 41093039
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea (PubChem CID 41093039) has the molecular formula C21H25F2N3OS2 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 41093039 |
| Molecular Formula | C21H25F2N3OS2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea |
| SMILES | COc1ccc([C@H](CNC(=S)Nc2ccc(SC(F)F)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25F2N3OS2/c1-27-17-8-4-15(5-9-17)19(26-12-2-3-13-26)14-24-21(28)25-16-6-10-18(11-7-16)29-20(22)23/h4-11,19-20H,2-3,12-14H2,1H3,(H2,24,25,28)/t19-/m0/s1 |
| InChIKey | RWESMSWETBMWNG-IBGZPJMESA-N |
| XLogP | 5.13 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|