C20H23F2N3S2 — CID 8657168
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea (PubChem CID 8657168) has the molecular formula C20H23F2N3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8657168 |
| Molecular Formula | C20H23F2N3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)NC[C@H](c2ccccc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H23F2N3S2/c21-19(22)27-17-10-8-16(9-11-17)24-20(26)23-14-18(25-12-4-5-13-25)15-6-2-1-3-7-15/h1-3,6-11,18-19H,4-5,12-14H2,(H2,23,24,26)/t18-/m1/s1 |
| InChIKey | SNBFFUAFTUZANL-GOSISDBHSA-N |
| XLogP | 5.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|