C23H23F2N3S2 — CID 2373479
1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(N-propan-2-ylanilino)phenyl]thiourea (PubChem CID 2373479) has the molecular formula C23H23F2N3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(N-propan-2-ylanilino)phenyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(N-propan-2-ylanilino)phenyl]thiourea |
|---|---|
| PubChem CID | 2373479 |
| Molecular Formula | C23H23F2N3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[4-(N-propan-2-ylanilino)phenyl]thiourea |
| SMILES | CC(C)N(c1ccccc1)c1ccc(NC(=S)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H23F2N3S2/c1-16(2)28(19-6-4-3-5-7-19)20-12-8-17(9-13-20)26-23(29)27-18-10-14-21(15-11-18)30-22(24)25/h3-16,22H,1-2H3,(H2,26,27,29) |
| InChIKey | BRVNMJSDHWUDBX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|