C22H29N3S — CID 23795770
1-cyclohexyl-3-[4-(N-propan-2-ylanilino)phenyl]thiourea (PubChem CID 23795770) has the molecular formula C22H29N3S and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(N-propan-2-ylanilino)phenyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-(N-propan-2-ylanilino)phenyl]thiourea |
|---|---|
| PubChem CID | 23795770 |
| Molecular Formula | C22H29N3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-cyclohexyl-3-[4-(N-propan-2-ylanilino)phenyl]thiourea |
| SMILES | CC(C)N(c1ccccc1)c1ccc(NC(=S)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N3S/c1-17(2)25(20-11-7-4-8-12-20)21-15-13-19(14-16-21)24-22(26)23-18-9-5-3-6-10-18/h4,7-8,11-18H,3,5-6,9-10H2,1-2H3,(H2,23,24,26) |
| InChIKey | QUYNLCSSXSQXBF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|