C15H22N2S — CID 724020
1-cyclohexyl-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 724020) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 724020 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-cyclohexyl-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | C[C@H](NC(=S)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2S/c1-12(13-8-4-2-5-9-13)16-15(18)17-14-10-6-3-7-11-14/h2,4-5,8-9,12,14H,3,6-7,10-11H2,1H3,(H2,16,17,18)/t12-/m0/s1 |
| InChIKey | HENUXILFJOCRKP-LBPRGKRZSA-N |
| XLogP | 3.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|