C19H22N2S — CID 57392119
1-cyclohexyl-3-(3-phenylphenyl)thiourea (PubChem CID 57392119) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3-phenylphenyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(3-phenylphenyl)thiourea |
|---|---|
| PubChem CID | 57392119 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-cyclohexyl-3-(3-phenylphenyl)thiourea |
| SMILES | S=C(Nc1cccc(-c2ccccc2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C19H22N2S/c22-19(20-17-11-5-2-6-12-17)21-18-13-7-10-16(14-18)15-8-3-1-4-9-15/h1,3-4,7-10,13-14,17H,2,5-6,11-12H2,(H2,20,21,22) |
| InChIKey | QSWDIIKVSCHWQV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|