C19H23N3O2S2 — CID 43075987
1-cyclohexyl-3-[3-(phenylsulfamoyl)phenyl]thiourea (PubChem CID 43075987) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-(phenylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[3-(phenylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 43075987 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-cyclohexyl-3-[3-(phenylsulfamoyl)phenyl]thiourea |
| SMILES | O=S(=O)(Nc1ccccc1)c1cccc(NC(=S)NC2CCCCC2)c1 |
| InChI | InChI=1S/C19H23N3O2S2/c23-26(24,22-16-10-5-2-6-11-16)18-13-7-12-17(14-18)21-19(25)20-15-8-3-1-4-9-15/h2,5-7,10-15,22H,1,3-4,8-9H2,(H2,20,21,25) |
| InChIKey | IMKLTBAEJKTKRC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|