C14H20N2O3S — CID 47314930
N-[3-(cyclohexylsulfamoyl)phenyl]acetamide (PubChem CID 47314930) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[3-(cyclohexylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47314930 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[3-(cyclohexylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(S(=O)(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-11(17)15-13-8-5-9-14(10-13)20(18,19)16-12-6-3-2-4-7-12/h5,8-10,12,16H,2-4,6-7H2,1H3,(H,15,17) |
| InChIKey | OVSHONQZAQLSRJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |