C16H20N2O3S — CID 42888967
N-[3-(cyclopropylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 42888967) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 42888967 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2CC2)c1)C1CC=CCC1 |
| InChI | InChI=1S/C16H20N2O3S/c19-16(12-5-2-1-3-6-12)17-14-7-4-8-15(11-14)22(20,21)18-13-9-10-13/h1-2,4,7-8,11-13,18H,3,5-6,9-10H2,(H,17,19) |
| InChIKey | KUSYTMLXPVVACU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|