C17H17NO — CID 8762294
(1R)-N-naphthalen-2-ylcyclohex-3-ene-1-carboxamide (PubChem CID 8762294) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (1R)-N-naphthalen-2-ylcyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-naphthalen-2-ylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 8762294 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (1R)-N-naphthalen-2-ylcyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C17H17NO/c19-17(14-7-2-1-3-8-14)18-16-11-10-13-6-4-5-9-15(13)12-16/h1-2,4-6,9-12,14H,3,7-8H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | JKHXTTXGRVXTST-AWEZNQCLSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|