C14H16N2O2 — CID 8885141
4-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]benzamide (PubChem CID 8885141) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]benzamide.
| Compound Name | 4-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]benzamide |
|---|---|
| PubChem CID | 8885141 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)[C@@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C14H16N2O2/c15-13(17)10-6-8-12(9-7-10)16-14(18)11-4-2-1-3-5-11/h1-2,6-9,11H,3-5H2,(H2,15,17)(H,16,18)/t11-/m1/s1 |
| InChIKey | WAAWNDGGFOERAC-LLVKDONJSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|