C22H36N4O5S2 — CID 20629800
4-(tert-butylsulfonylamino)-N-[3-(cyclohexylsulfamoyl)phenyl]piperidine-1-carboxamide (PubChem CID 20629800) has the molecular formula C22H36N4O5S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 4-(tert-butylsulfonylamino)-N-[3-(cyclohexylsulfamoyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(tert-butylsulfonylamino)-N-[3-(cyclohexylsulfamoyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20629800 |
| Molecular Formula | C22H36N4O5S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 4-(tert-butylsulfonylamino)-N-[3-(cyclohexylsulfamoyl)phenyl]piperidine-1-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCN(C(=O)Nc2cccc(S(=O)(=O)NC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C22H36N4O5S2/c1-22(2,3)33(30,31)25-18-12-14-26(15-13-18)21(27)23-19-10-7-11-20(16-19)32(28,29)24-17-8-5-4-6-9-17/h7,10-11,16-18,24-25H,4-6,8-9,12-15H2,1-3H3,(H,23,27) |
| InChIKey | MSLHARSCZVAYTA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |