C18H30N4O5S2 — CID 20629890
N-[3-(propan-2-ylsulfamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 20629890) has the molecular formula C18H30N4O5S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[3-(propan-2-ylsulfamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-[3-(propan-2-ylsulfamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20629890 |
| Molecular Formula | C18H30N4O5S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[3-(propan-2-ylsulfamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(NC(=O)N2CCC(NS(=O)(=O)C(C)C)CC2)c1 |
| InChI | InChI=1S/C18H30N4O5S2/c1-13(2)20-29(26,27)17-7-5-6-16(12-17)19-18(23)22-10-8-15(9-11-22)21-28(24,25)14(3)4/h5-7,12-15,20-21H,8-11H2,1-4H3,(H,19,23) |
| InChIKey | HLXHOKIZGZLYDY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |