C20H32N4O5S2 — CID 20628894
N-(4-piperidin-1-ylsulfonylphenyl)-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 20628894) has the molecular formula C20H32N4O5S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-(4-piperidin-1-ylsulfonylphenyl)-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-(4-piperidin-1-ylsulfonylphenyl)-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20628894 |
| Molecular Formula | C20H32N4O5S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-(4-piperidin-1-ylsulfonylphenyl)-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(C)S(=O)(=O)NC1CCN(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H32N4O5S2/c1-16(2)30(26,27)22-18-10-14-23(15-11-18)20(25)21-17-6-8-19(9-7-17)31(28,29)24-12-4-3-5-13-24/h6-9,16,18,22H,3-5,10-15H2,1-2H3,(H,21,25) |
| InChIKey | IDOLELDCGLZVFR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |