C21H34N3O3S+ — CID 7509633
cyclooctyl-[(2R)-1-oxo-1-(4-pyrrolidin-1-ylsulfonylanilino)propan-2-yl]azanium (PubChem CID 7509633) has the molecular formula C21H34N3O3S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is cyclooctyl-[(2R)-1-oxo-1-(4-pyrrolidin-1-ylsulfonylanilino)propan-2-yl]azanium.
| Compound Name | cyclooctyl-[(2R)-1-oxo-1-(4-pyrrolidin-1-ylsulfonylanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 7509633 |
| Molecular Formula | C21H34N3O3S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | cyclooctyl-[(2R)-1-oxo-1-(4-pyrrolidin-1-ylsulfonylanilino)propan-2-yl]azanium |
| SMILES | C[C@@H]([NH2+]C1CCCCCCC1)C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H33N3O3S/c1-17(22-18-9-5-3-2-4-6-10-18)21(25)23-19-11-13-20(14-12-19)28(26,27)24-15-7-8-16-24/h11-14,17-18,22H,2-10,15-16H2,1H3,(H,23,25)/p+1/t17-/m1/s1 |
| InChIKey | LNBAXGFMYHPTQO-QGZVFWFLSA-O |
| XLogP | 2.47 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |