C18H26N2O3S2 — CID 7825678
(2S)-2-cyclopentylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 7825678) has the molecular formula C18H26N2O3S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is (2S)-2-cyclopentylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | (2S)-2-cyclopentylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 7825678 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2S)-2-cyclopentylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | C[C@H](SC1CCCC1)C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O3S2/c1-14(24-16-6-2-3-7-16)18(21)19-15-8-10-17(11-9-15)25(22,23)20-12-4-5-13-20/h8-11,14,16H,2-7,12-13H2,1H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | PRCHTSAZFYUQEO-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |