C19H21BrN2O3S2 — CID 4821866
2-(4-bromophenyl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 4821866) has the molecular formula C19H21BrN2O3S2 and a molecular weight of 469.43 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 4821866 |
| Molecular Formula | C19H21BrN2O3S2 |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(Sc1ccc(Br)cc1)C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H21BrN2O3S2/c1-14(26-17-8-4-15(20)5-9-17)19(23)21-16-6-10-18(11-7-16)27(24,25)22-12-2-3-13-22/h4-11,14H,2-3,12-13H2,1H3,(H,21,23) |
| InChIKey | OBRHDIRDMADSHJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |