C18H21N3O4S2 — CID 7795520
(2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 7795520) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | (2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 7795520 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | C[C@@H](Sc1cccc[n+]1[O-])C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-14(26-17-6-2-3-13-21(17)23)18(22)19-15-7-9-16(10-8-15)27(24,25)20-11-4-5-12-20/h2-3,6-10,13-14H,4-5,11-12H2,1H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | XOQSCKURMDZEKC-CQSZACIVSA-N |
| XLogP | 2.22 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|