C18H21N3O5S2 — CID 40786655
(2R)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide (PubChem CID 40786655) has the molecular formula C18H21N3O5S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (2R)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 40786655 |
| Molecular Formula | C18H21N3O5S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (2R)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1cccc[n+]1[O-])C(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H21N3O5S2/c1-14(27-17-7-2-3-8-21(17)23)18(22)19-15-5-4-6-16(13-15)28(24,25)20-9-11-26-12-10-20/h2-8,13-14H,9-12H2,1H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | QNXQLMCVIDCABW-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|