C23H26N4O4S2 — CID 43029497
2-(1-methyl-5-phenylimidazol-2-yl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 43029497) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-(1-methyl-5-phenylimidazol-2-yl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | 2-(1-methyl-5-phenylimidazol-2-yl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 43029497 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-(1-methyl-5-phenylimidazol-2-yl)sulfanyl-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | CC(Sc1ncc(-c2ccccc2)n1C)C(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-17(32-23-24-16-21(26(23)2)18-7-4-3-5-8-18)22(28)25-19-9-6-10-20(15-19)33(29,30)27-11-13-31-14-12-27/h3-10,15-17H,11-14H2,1-2H3,(H,25,28) |
| InChIKey | YBLSVFVIALDQAR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |