C20H27N4O4S+ — CID 8863476
(2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 8863476) has the molecular formula C20H27N4O4S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is (2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | (2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 8863476 |
| Molecular Formula | C20H27N4O4S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H26N4O4S/c1-16(23-9-7-18(8-10-23)22(2)3)20(25)21-17-5-4-6-19(15-17)29(26,27)24-11-13-28-14-12-24/h4-10,15-16H,11-14H2,1-3H3/p+1/t16-/m1/s1 |
| InChIKey | YHRWKFHDDHIZBM-MRXNPFEDSA-O |
| XLogP | 1.26 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|