C22H26N4O3S2 — CID 42975704
2-(1-methylbenzimidazol-2-yl)sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 42975704) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 42975704 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(Sc1nc2ccccc2n1C)C(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-16(30-22-24-19-8-4-5-9-20(19)25(22)2)21(27)23-17-10-12-18(13-11-17)31(28,29)26-14-6-3-7-15-26/h4-5,8-13,16H,3,6-7,14-15H2,1-2H3,(H,23,27) |
| InChIKey | OZCTXGSACBCWCM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |