C16H17N3O3S — CID 7795389
(2S)-N-(4-acetamidophenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide (PubChem CID 7795389) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is (2S)-N-(4-acetamidophenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(4-acetamidophenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7795389 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (2S)-N-(4-acetamidophenyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H](C)Sc2cccc[n+]2[O-])cc1 |
| InChI | InChI=1S/C16H17N3O3S/c1-11(23-15-5-3-4-10-19(15)22)16(21)18-14-8-6-13(7-9-14)17-12(2)20/h3-11H,1-2H3,(H,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | SRNWBZRIFFDGGF-NSHDSACASA-N |
| XLogP | 2.40 |
| TPSA | 85.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|