C21H20N2O3S — CID 8605463
(2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)propanamide (PubChem CID 8605463) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | (2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 8605463 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (2R)-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)propanamide |
| SMILES | C[C@@H](Sc1cccc[n+]1[O-])C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-16(27-20-9-5-6-14-23(20)25)21(24)22-18-10-12-19(13-11-18)26-15-17-7-3-2-4-8-17/h2-14,16H,15H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | SYXWFMRKBWBTSV-MRXNPFEDSA-N |
| XLogP | 4.02 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|