C22H16N2O4S — CID 8605480
(2S)-N-(9,10-dioxoanthracen-2-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide (PubChem CID 8605480) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is (2S)-N-(9,10-dioxoanthracen-2-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(9,10-dioxoanthracen-2-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8605480 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (2S)-N-(9,10-dioxoanthracen-2-yl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1cccc[n+]1[O-])C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H16N2O4S/c1-13(29-19-8-4-5-11-24(19)28)22(27)23-14-9-10-17-18(12-14)21(26)16-7-3-2-6-15(16)20(17)25/h2-13H,1H3,(H,23,27)/t13-/m0/s1 |
| InChIKey | CWWTVQWYHWCKIE-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|