C24H24N2O3S2 — CID 2928700
2-phenyl-2-phenylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 2928700) has the molecular formula C24H24N2O3S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-phenyl-2-phenylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-phenyl-2-phenylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 2928700 |
| Molecular Formula | C24H24N2O3S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-phenyl-2-phenylsulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O3S2/c27-24(23(19-9-3-1-4-10-19)30-21-11-5-2-6-12-21)25-20-13-15-22(16-14-20)31(28,29)26-17-7-8-18-26/h1-6,9-16,23H,7-8,17-18H2,(H,25,27) |
| InChIKey | ZFQPDUGDFQFUFC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |