C25H27N3OS — CID 30857945
(2S)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 30857945) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is (2S)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2S)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 30857945 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2S)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)[C@@H](Sc3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H27N3OS/c1-27-16-18-28(19-17-27)22-14-12-21(13-15-22)26-25(29)24(20-8-4-2-5-9-20)30-23-10-6-3-7-11-23/h2-15,24H,16-19H2,1H3,(H,26,29)/t24-/m0/s1 |
| InChIKey | XSVJPGFYYXUKMC-DEOSSOPVSA-N |
| XLogP | 4.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|