C20H17NOS — CID 821034
(2S)-N,2-diphenyl-2-phenylsulfanylacetamide (PubChem CID 821034) has the molecular formula C20H17NOS and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S)-N,2-diphenyl-2-phenylsulfanylacetamide.
| Compound Name | (2S)-N,2-diphenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 821034 |
| Molecular Formula | C20H17NOS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S)-N,2-diphenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1ccccc1)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17NOS/c22-20(21-17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)23-18-14-8-3-9-15-18/h1-15,19H,(H,21,22)/t19-/m0/s1 |
| InChIKey | WWDLJOHWDDGBLL-IBGZPJMESA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |