C20H15F2NOS — CID 17271870
N-(3,5-difluorophenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 17271870) has the molecular formula C20H15F2NOS and a molecular weight of 355.41 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 17271870 |
| Molecular Formula | C20H15F2NOS |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15F2NOS/c21-15-11-16(22)13-17(12-15)23-20(24)19(14-7-3-1-4-8-14)25-18-9-5-2-6-10-18/h1-13,19H,(H,23,24) |
| InChIKey | YWNNJRYXTOKEOK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |