C20H16ClNOS — CID 2904145
N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 2904145) has the molecular formula C20H16ClNOS and a molecular weight of 353.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2904145 |
| Molecular Formula | C20H16ClNOS |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1ccccc1Cl)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16ClNOS/c21-17-13-7-8-14-18(17)22-20(23)19(15-9-3-1-4-10-15)24-16-11-5-2-6-12-16/h1-14,19H,(H,22,23) |
| InChIKey | UUSINBDCVHACIR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |